C27H25N3O4S2 — CID 43944688
4-(2,3-dihydroindol-1-ylsulfonyl)-N-(4-ethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 43944688) has the molecular formula C27H25N3O4S2 and a molecular weight of 519.65 g/mol. Its IUPAC name is 4-(2,3-dihydroindol-1-ylsulfonyl)-N-(4-ethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 4-(2,3-dihydroindol-1-ylsulfonyl)-N-(4-ethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 43944688 |
| Molecular Formula | C27H25N3O4S2 |
| Molecular Weight | 519.65 g/mol |
| Exact Mass | 519.13 |
| IUPAC Name | 4-(2,3-dihydroindol-1-ylsulfonyl)-N-(4-ethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | C=CCn1/c(=N/C(=O)c2ccc(S(=O)(=O)N3CCc4ccccc43)cc2)sc2cccc(OCC)c21 |
| InChI | InChI=1S/C27H25N3O4S2/c1-3-17-29-25-23(34-4-2)10-7-11-24(25)35-27(29)28-26(31)20-12-14-21(15-13-20)36(32,33)30-18-16-19-8-5-6-9-22(19)30/h3,5-15H,1,4,16-18H2,2H3/b28-27- |
| InChIKey | SCYGNLODWVMUAT-DQSJHHFOSA-N |
| XLogP | 4.78 |
| TPSA | 80.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.65 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|