C28H25N3O5S2 — CID 3459556
methyl 2-[4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)benzoyl]imino-3-prop-2-enyl-1,3-benzothiazole-6-carboxylate (PubChem CID 3459556) has the molecular formula C28H25N3O5S2 and a molecular weight of 547.66 g/mol. Its IUPAC name is methyl 2-[4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)benzoyl]imino-3-prop-2-enyl-1,3-benzothiazole-6-carboxylate.
| Compound Name | methyl 2-[4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)benzoyl]imino-3-prop-2-enyl-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 3459556 |
| Molecular Formula | C28H25N3O5S2 |
| Molecular Weight | 547.66 g/mol |
| Exact Mass | 547.12 |
| IUPAC Name | methyl 2-[4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)benzoyl]imino-3-prop-2-enyl-1,3-benzothiazole-6-carboxylate |
| SMILES | C=CCn1/c(=N\C(=O)c2ccc(S(=O)(=O)N3CCCc4ccccc43)cc2)sc2cc(C(=O)OC)ccc21 |
| InChI | InChI=1S/C28H25N3O5S2/c1-3-16-30-24-15-12-21(27(33)36-2)18-25(24)37-28(30)29-26(32)20-10-13-22(14-11-20)38(34,35)31-17-6-8-19-7-4-5-9-23(19)31/h3-5,7,9-15,18H,1,6,8,16-17H2,2H3/b29-28+ |
| InChIKey | BIXNYYGLUUMODW-ZQHSETAFSA-N |
| XLogP | 4.56 |
| TPSA | 98.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.66 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|