C28H29N3O5S2 — CID 4187857
4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)-N-[3-(2-ethoxyethyl)-6-methoxy-1,3-benzothiazol-2-ylidene]benzamide (PubChem CID 4187857) has the molecular formula C28H29N3O5S2 and a molecular weight of 551.69 g/mol. Its IUPAC name is 4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)-N-[3-(2-ethoxyethyl)-6-methoxy-1,3-benzothiazol-2-ylidene]benzamide.
| Compound Name | 4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)-N-[3-(2-ethoxyethyl)-6-methoxy-1,3-benzothiazol-2-ylidene]benzamide |
|---|---|
| PubChem CID | 4187857 |
| Molecular Formula | C28H29N3O5S2 |
| Molecular Weight | 551.69 g/mol |
| Exact Mass | 551.15 |
| IUPAC Name | 4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)-N-[3-(2-ethoxyethyl)-6-methoxy-1,3-benzothiazol-2-ylidene]benzamide |
| SMILES | CCOCCn1/c(=N\C(=O)c2ccc(S(=O)(=O)N3CCCc4ccccc43)cc2)sc2cc(OC)ccc21 |
| InChI | InChI=1S/C28H29N3O5S2/c1-3-36-18-17-30-25-15-12-22(35-2)19-26(25)37-28(30)29-27(32)21-10-13-23(14-11-21)38(33,34)31-16-6-8-20-7-4-5-9-24(20)31/h4-5,7,9-15,19H,3,6,8,16-18H2,1-2H3/b29-28+ |
| InChIKey | GUINMPLHSCOWFM-ZQHSETAFSA-N |
| XLogP | 4.63 |
| TPSA | 90.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.69 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|