C27H27N3O4S2 — CID 3363839
4-(2,3-dihydroindol-1-ylsulfonyl)-N-[3-(2-ethoxyethyl)-6-methyl-1,3-benzothiazol-2-ylidene]benzamide (PubChem CID 3363839) has the molecular formula C27H27N3O4S2 and a molecular weight of 521.66 g/mol. Its IUPAC name is 4-(2,3-dihydroindol-1-ylsulfonyl)-N-[3-(2-ethoxyethyl)-6-methyl-1,3-benzothiazol-2-ylidene]benzamide.
| Compound Name | 4-(2,3-dihydroindol-1-ylsulfonyl)-N-[3-(2-ethoxyethyl)-6-methyl-1,3-benzothiazol-2-ylidene]benzamide |
|---|---|
| PubChem CID | 3363839 |
| Molecular Formula | C27H27N3O4S2 |
| Molecular Weight | 521.66 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | 4-(2,3-dihydroindol-1-ylsulfonyl)-N-[3-(2-ethoxyethyl)-6-methyl-1,3-benzothiazol-2-ylidene]benzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2ccc(S(=O)(=O)N3CCc4ccccc43)cc2)sc2cc(C)ccc21 |
| InChI | InChI=1S/C27H27N3O4S2/c1-3-34-17-16-29-24-13-8-19(2)18-25(24)35-27(29)28-26(31)21-9-11-22(12-10-21)36(32,33)30-15-14-20-6-4-5-7-23(20)30/h4-13,18H,3,14-17H2,1-2H3/b28-27- |
| InChIKey | XXASYBYWUBJPFN-DQSJHHFOSA-N |
| XLogP | 4.54 |
| TPSA | 80.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.66 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|