C26H21N3O5S3 — CID 3453290
4-(2,3-dihydroindol-1-ylsulfonyl)-N-(6-methylsulfonyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 3453290) has the molecular formula C26H21N3O5S3 and a molecular weight of 551.67 g/mol. Its IUPAC name is 4-(2,3-dihydroindol-1-ylsulfonyl)-N-(6-methylsulfonyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 4-(2,3-dihydroindol-1-ylsulfonyl)-N-(6-methylsulfonyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 3453290 |
| Molecular Formula | C26H21N3O5S3 |
| Molecular Weight | 551.67 g/mol |
| Exact Mass | 551.06 |
| IUPAC Name | 4-(2,3-dihydroindol-1-ylsulfonyl)-N-(6-methylsulfonyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | C#CCn1/c(=N/C(=O)c2ccc(S(=O)(=O)N3CCc4ccccc43)cc2)sc2cc(S(C)(=O)=O)ccc21 |
| InChI | InChI=1S/C26H21N3O5S3/c1-3-15-28-23-13-12-21(36(2,31)32)17-24(23)35-26(28)27-25(30)19-8-10-20(11-9-19)37(33,34)29-16-14-18-6-4-5-7-22(18)29/h1,4-13,17H,14-16H2,2H3/b27-26- |
| InChIKey | HMMYHHADUDBPNQ-RQZHXJHFSA-N |
| XLogP | 3.23 |
| TPSA | 105.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.67 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|