C27H23N3O3S2 — CID 40885918
4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)-N-(4-methyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 40885918) has the molecular formula C27H23N3O3S2 and a molecular weight of 501.63 g/mol. Its IUPAC name is 4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)-N-(4-methyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)-N-(4-methyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 40885918 |
| Molecular Formula | C27H23N3O3S2 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.12 |
| IUPAC Name | 4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)-N-(4-methyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | C#CCn1/c(=N/C(=O)c2ccc(S(=O)(=O)N3CCCc4ccccc43)cc2)sc2cccc(C)c21 |
| InChI | InChI=1S/C27H23N3O3S2/c1-3-17-29-25-19(2)8-6-12-24(25)34-27(29)28-26(31)21-13-15-22(16-14-21)35(32,33)30-18-7-10-20-9-4-5-11-23(20)30/h1,4-6,8-9,11-16H,7,10,17-18H2,2H3/b28-27- |
| InChIKey | CSLIBSZPGOYUGA-DQSJHHFOSA-N |
| XLogP | 4.53 |
| TPSA | 71.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|