C27H26FN3O4S2 — CID 3347992
4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)-N-[3-(2-ethoxyethyl)-4-fluoro-1,3-benzothiazol-2-ylidene]benzamide (PubChem CID 3347992) has the molecular formula C27H26FN3O4S2 and a molecular weight of 539.65 g/mol. Its IUPAC name is 4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)-N-[3-(2-ethoxyethyl)-4-fluoro-1,3-benzothiazol-2-ylidene]benzamide.
| Compound Name | 4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)-N-[3-(2-ethoxyethyl)-4-fluoro-1,3-benzothiazol-2-ylidene]benzamide |
|---|---|
| PubChem CID | 3347992 |
| Molecular Formula | C27H26FN3O4S2 |
| Molecular Weight | 539.65 g/mol |
| Exact Mass | 539.13 |
| IUPAC Name | 4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)-N-[3-(2-ethoxyethyl)-4-fluoro-1,3-benzothiazol-2-ylidene]benzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2ccc(S(=O)(=O)N3CCCc4ccccc43)cc2)sc2cccc(F)c21 |
| InChI | InChI=1S/C27H26FN3O4S2/c1-2-35-18-17-30-25-22(28)9-5-11-24(25)36-27(30)29-26(32)20-12-14-21(15-13-20)37(33,34)31-16-6-8-19-7-3-4-10-23(19)31/h3-5,7,9-15H,2,6,8,16-18H2,1H3/b29-27- |
| InChIKey | MKWAPYSAQLNJNK-OHYPFYFLSA-N |
| XLogP | 4.76 |
| TPSA | 80.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.65 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|