C21H23FN2O4S2 — CID 41148839
N-[3-(2-ethoxyethyl)-4-fluoro-1,3-benzothiazol-2-ylidene]-4-propan-2-ylsulfonylbenzamide (PubChem CID 41148839) has the molecular formula C21H23FN2O4S2 and a molecular weight of 450.56 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-4-fluoro-1,3-benzothiazol-2-ylidene]-4-propan-2-ylsulfonylbenzamide.
| Compound Name | N-[3-(2-ethoxyethyl)-4-fluoro-1,3-benzothiazol-2-ylidene]-4-propan-2-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 41148839 |
| Molecular Formula | C21H23FN2O4S2 |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-4-fluoro-1,3-benzothiazol-2-ylidene]-4-propan-2-ylsulfonylbenzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2ccc(S(=O)(=O)C(C)C)cc2)sc2cccc(F)c21 |
| InChI | InChI=1S/C21H23FN2O4S2/c1-4-28-13-12-24-19-17(22)6-5-7-18(19)29-21(24)23-20(25)15-8-10-16(11-9-15)30(26,27)14(2)3/h5-11,14H,4,12-13H2,1-3H3/b23-21- |
| InChIKey | FCGYSLFSTIAURO-LNVKXUELSA-N |
| XLogP | 3.80 |
| TPSA | 77.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|