C25H23FN2O2S — CID 5055627
N-[3-(2-ethoxyethyl)-4-fluoro-1,3-benzothiazol-2-ylidene]-2,2-diphenylacetamide (PubChem CID 5055627) has the molecular formula C25H23FN2O2S and a molecular weight of 434.54 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-4-fluoro-1,3-benzothiazol-2-ylidene]-2,2-diphenylacetamide.
| Compound Name | N-[3-(2-ethoxyethyl)-4-fluoro-1,3-benzothiazol-2-ylidene]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 5055627 |
| Molecular Formula | C25H23FN2O2S |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-4-fluoro-1,3-benzothiazol-2-ylidene]-2,2-diphenylacetamide |
| SMILES | CCOCCn1/c(=N/C(=O)C(c2ccccc2)c2ccccc2)sc2cccc(F)c21 |
| InChI | InChI=1S/C25H23FN2O2S/c1-2-30-17-16-28-23-20(26)14-9-15-21(23)31-25(28)27-24(29)22(18-10-5-3-6-11-18)19-12-7-4-8-13-19/h3-15,22H,2,16-17H2,1H3/b27-25- |
| InChIKey | RYILNSZOVDJFFK-RFBIWTDZSA-N |
| XLogP | 5.14 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|