C20H18ClFN2O2S — CID 4051535
3-(2-chlorophenyl)-N-[3-(2-ethoxyethyl)-4-fluoro-1,3-benzothiazol-2-ylidene]prop-2-enamide (PubChem CID 4051535) has the molecular formula C20H18ClFN2O2S and a molecular weight of 404.89 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-[3-(2-ethoxyethyl)-4-fluoro-1,3-benzothiazol-2-ylidene]prop-2-enamide.
| Compound Name | 3-(2-chlorophenyl)-N-[3-(2-ethoxyethyl)-4-fluoro-1,3-benzothiazol-2-ylidene]prop-2-enamide |
|---|---|
| PubChem CID | 4051535 |
| Molecular Formula | C20H18ClFN2O2S |
| Molecular Weight | 404.89 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 3-(2-chlorophenyl)-N-[3-(2-ethoxyethyl)-4-fluoro-1,3-benzothiazol-2-ylidene]prop-2-enamide |
| SMILES | CCOCCn1/c(=N/C(=O)C=Cc2ccccc2Cl)sc2cccc(F)c21 |
| InChI | InChI=1S/C20H18ClFN2O2S/c1-2-26-13-12-24-19-16(22)8-5-9-17(19)27-20(24)23-18(25)11-10-14-6-3-4-7-15(14)21/h3-11H,2,12-13H2,1H3/b11-10?,23-20- |
| InChIKey | SJWBTSFRHHPREF-TYPJZVEYSA-N |
| XLogP | 4.67 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.89 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|