C18H16F2N2O2S2 — CID 7141537
(E)-N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]-3-thiophen-2-ylprop-2-enamide (PubChem CID 7141537) has the molecular formula C18H16F2N2O2S2 and a molecular weight of 394.47 g/mol. Its IUPAC name is (E)-N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 7141537 |
| Molecular Formula | C18H16F2N2O2S2 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | (E)-N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]-3-thiophen-2-ylprop-2-enamide |
| SMILES | CCOCCn1/c(=N/C(=O)/C=C/c2cccs2)sc2cc(F)cc(F)c21 |
| InChI | InChI=1S/C18H16F2N2O2S2/c1-2-24-8-7-22-17-14(20)10-12(19)11-15(17)26-18(22)21-16(23)6-5-13-4-3-9-25-13/h3-6,9-11H,2,7-8H2,1H3/b6-5+,21-18- |
| InChIKey | ZHHWYZQLQQQKSL-YNOSFFGSSA-N |
| XLogP | 4.22 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|