C17H14F2N2O2S2 — CID 4258451
N-[4,6-difluoro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]-3-thiophen-2-ylprop-2-enamide (PubChem CID 4258451) has the molecular formula C17H14F2N2O2S2 and a molecular weight of 380.44 g/mol. Its IUPAC name is N-[4,6-difluoro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | N-[4,6-difluoro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 4258451 |
| Molecular Formula | C17H14F2N2O2S2 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | N-[4,6-difluoro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]-3-thiophen-2-ylprop-2-enamide |
| SMILES | COCCn1/c(=N/C(=O)C=Cc2cccs2)sc2cc(F)cc(F)c21 |
| InChI | InChI=1S/C17H14F2N2O2S2/c1-23-7-6-21-16-13(19)9-11(18)10-14(16)25-17(21)20-15(22)5-4-12-3-2-8-24-12/h2-5,8-10H,6-7H2,1H3/b5-4?,20-17- |
| InChIKey | ZJCPPTIKOWCGFE-AFABCKLRSA-N |
| XLogP | 3.83 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|