C16H13FN2OS2 — CID 5212529
N-(3-ethyl-4-fluoro-1,3-benzothiazol-2-ylidene)-3-thiophen-2-ylprop-2-enamide (PubChem CID 5212529) has the molecular formula C16H13FN2OS2 and a molecular weight of 332.43 g/mol. Its IUPAC name is N-(3-ethyl-4-fluoro-1,3-benzothiazol-2-ylidene)-3-thiophen-2-ylprop-2-enamide.
| Compound Name | N-(3-ethyl-4-fluoro-1,3-benzothiazol-2-ylidene)-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 5212529 |
| Molecular Formula | C16H13FN2OS2 |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | N-(3-ethyl-4-fluoro-1,3-benzothiazol-2-ylidene)-3-thiophen-2-ylprop-2-enamide |
| SMILES | CCn1/c(=N/C(=O)C=Cc2cccs2)sc2cccc(F)c21 |
| InChI | InChI=1S/C16H13FN2OS2/c1-2-19-15-12(17)6-3-7-13(15)22-16(19)18-14(20)9-8-11-5-4-10-21-11/h3-10H,2H2,1H3/b9-8?,18-16- |
| InChIKey | INZGQGYHTKSVFK-FTXWXEGRSA-N |
| XLogP | 4.06 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|