C17H16N2O2S2 — CID 4157826
N-(4-ethoxy-3-methyl-1,3-benzothiazol-2-ylidene)-3-thiophen-2-ylprop-2-enamide (PubChem CID 4157826) has the molecular formula C17H16N2O2S2 and a molecular weight of 344.46 g/mol. Its IUPAC name is N-(4-ethoxy-3-methyl-1,3-benzothiazol-2-ylidene)-3-thiophen-2-ylprop-2-enamide.
| Compound Name | N-(4-ethoxy-3-methyl-1,3-benzothiazol-2-ylidene)-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 4157826 |
| Molecular Formula | C17H16N2O2S2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | N-(4-ethoxy-3-methyl-1,3-benzothiazol-2-ylidene)-3-thiophen-2-ylprop-2-enamide |
| SMILES | CCOc1cccc2s/c(=N\C(=O)C=Cc3cccs3)n(C)c12 |
| InChI | InChI=1S/C17H16N2O2S2/c1-3-21-13-7-4-8-14-16(13)19(2)17(23-14)18-15(20)10-9-12-6-5-11-22-12/h4-11H,3H2,1-2H3/b10-9?,18-17- |
| InChIKey | ZESKOMSHAONQOV-GPAUUMAZSA-N |
| XLogP | 3.84 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|