C19H14N2OS2 — CID 4670195
N-(1-methylbenzo[e][1,3]benzothiazol-2-ylidene)-3-thiophen-2-ylprop-2-enamide (PubChem CID 4670195) has the molecular formula C19H14N2OS2 and a molecular weight of 350.47 g/mol. Its IUPAC name is N-(1-methylbenzo[e][1,3]benzothiazol-2-ylidene)-3-thiophen-2-ylprop-2-enamide.
| Compound Name | N-(1-methylbenzo[e][1,3]benzothiazol-2-ylidene)-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 4670195 |
| Molecular Formula | C19H14N2OS2 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | N-(1-methylbenzo[e][1,3]benzothiazol-2-ylidene)-3-thiophen-2-ylprop-2-enamide |
| SMILES | Cn1/c(=N/C(=O)C=Cc2cccs2)sc2ccc3ccccc3c21 |
| InChI | InChI=1S/C19H14N2OS2/c1-21-18-15-7-3-2-5-13(15)8-10-16(18)24-19(21)20-17(22)11-9-14-6-4-12-23-14/h2-12H,1H3/b11-9?,20-19- |
| InChIKey | AZPUNDYIYWBTLY-FLIJJAHTSA-N |
| XLogP | 4.60 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|