C22H20N2O2S2 — CID 41202896
(E)-N-[3-(2-ethoxyethyl)benzo[g][1,3]benzothiazol-2-ylidene]-3-thiophen-2-ylprop-2-enamide (PubChem CID 41202896) has the molecular formula C22H20N2O2S2 and a molecular weight of 408.55 g/mol. Its IUPAC name is (E)-N-[3-(2-ethoxyethyl)benzo[g][1,3]benzothiazol-2-ylidene]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-[3-(2-ethoxyethyl)benzo[g][1,3]benzothiazol-2-ylidene]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 41202896 |
| Molecular Formula | C22H20N2O2S2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | (E)-N-[3-(2-ethoxyethyl)benzo[g][1,3]benzothiazol-2-ylidene]-3-thiophen-2-ylprop-2-enamide |
| SMILES | CCOCCn1/c(=N/C(=O)/C=C/c2cccs2)sc2c3ccccc3ccc21 |
| InChI | InChI=1S/C22H20N2O2S2/c1-2-26-14-13-24-19-11-9-16-6-3-4-8-18(16)21(19)28-22(24)23-20(25)12-10-17-7-5-15-27-17/h3-12,15H,2,13-14H2,1H3/b12-10+,23-22- |
| InChIKey | RQNAKLBFOXDWCF-LMAVEHNKSA-N |
| XLogP | 5.09 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|