C18H19N3O4S3 — CID 3598019
N-[3-(2-ethoxyethyl)-6-sulfamoyl-1,3-benzothiazol-2-ylidene]-3-thiophen-2-ylprop-2-enamide (PubChem CID 3598019) has the molecular formula C18H19N3O4S3 and a molecular weight of 437.57 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-6-sulfamoyl-1,3-benzothiazol-2-ylidene]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | N-[3-(2-ethoxyethyl)-6-sulfamoyl-1,3-benzothiazol-2-ylidene]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 3598019 |
| Molecular Formula | C18H19N3O4S3 |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-6-sulfamoyl-1,3-benzothiazol-2-ylidene]-3-thiophen-2-ylprop-2-enamide |
| SMILES | CCOCCn1/c(=N/C(=O)C=Cc2cccs2)sc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C18H19N3O4S3/c1-2-25-10-9-21-15-7-6-14(28(19,23)24)12-16(15)27-18(21)20-17(22)8-5-13-4-3-11-26-13/h3-8,11-12H,2,9-10H2,1H3,(H2,19,23,24)/b8-5?,20-18- |
| InChIKey | ILLBQIMHAAJXIP-PMNABCFNSA-N |
| XLogP | 2.59 |
| TPSA | 103.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|