C15H21N3O4S2 — CID 5054221
N-[3-(2-ethoxyethyl)-6-sulfamoyl-1,3-benzothiazol-2-ylidene]butanamide (PubChem CID 5054221) has the molecular formula C15H21N3O4S2 and a molecular weight of 371.48 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-6-sulfamoyl-1,3-benzothiazol-2-ylidene]butanamide.
| Compound Name | N-[3-(2-ethoxyethyl)-6-sulfamoyl-1,3-benzothiazol-2-ylidene]butanamide |
|---|---|
| PubChem CID | 5054221 |
| Molecular Formula | C15H21N3O4S2 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-6-sulfamoyl-1,3-benzothiazol-2-ylidene]butanamide |
| SMILES | CCCC(=O)/N=c1\sc2cc(S(N)(=O)=O)ccc2n1CCOCC |
| InChI | InChI=1S/C15H21N3O4S2/c1-3-5-14(19)17-15-18(8-9-22-4-2)12-7-6-11(24(16,20)21)10-13(12)23-15/h6-7,10H,3-5,8-9H2,1-2H3,(H2,16,20,21)/b17-15- |
| InChIKey | XFZDHEDIPNLEQE-ICFOKQHNSA-N |
| XLogP | 1.61 |
| TPSA | 103.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|