C21H19N3O6S2 — CID 3675927
N-[3-(2-ethoxyethyl)-6-sulfamoyl-1,3-benzothiazol-2-ylidene]-4-oxochromene-2-carboxamide (PubChem CID 3675927) has the molecular formula C21H19N3O6S2 and a molecular weight of 473.53 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-6-sulfamoyl-1,3-benzothiazol-2-ylidene]-4-oxochromene-2-carboxamide.
| Compound Name | N-[3-(2-ethoxyethyl)-6-sulfamoyl-1,3-benzothiazol-2-ylidene]-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 3675927 |
| Molecular Formula | C21H19N3O6S2 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.07 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-6-sulfamoyl-1,3-benzothiazol-2-ylidene]-4-oxochromene-2-carboxamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2cc(=O)c3ccccc3o2)sc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C21H19N3O6S2/c1-2-29-10-9-24-15-8-7-13(32(22,27)28)11-19(15)31-21(24)23-20(26)18-12-16(25)14-5-3-4-6-17(14)30-18/h3-8,11-12H,2,9-10H2,1H3,(H2,22,27,28)/b23-21- |
| InChIKey | PCICGZNTFYWWBW-LNVKXUELSA-N |
| XLogP | 2.23 |
| TPSA | 133.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|