C20H23N3O6S2 — CID 16848956
N-[3-(2-ethoxyethyl)-6-sulfamoyl-1,3-benzothiazol-2-ylidene]-2,5-dimethoxybenzamide (PubChem CID 16848956) has the molecular formula C20H23N3O6S2 and a molecular weight of 465.55 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-6-sulfamoyl-1,3-benzothiazol-2-ylidene]-2,5-dimethoxybenzamide.
| Compound Name | N-[3-(2-ethoxyethyl)-6-sulfamoyl-1,3-benzothiazol-2-ylidene]-2,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 16848956 |
| Molecular Formula | C20H23N3O6S2 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-6-sulfamoyl-1,3-benzothiazol-2-ylidene]-2,5-dimethoxybenzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2cc(OC)ccc2OC)sc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C20H23N3O6S2/c1-4-29-10-9-23-16-7-6-14(31(21,25)26)12-18(16)30-20(23)22-19(24)15-11-13(27-2)5-8-17(15)28-3/h5-8,11-12H,4,9-10H2,1-3H3,(H2,21,25,26)/b22-20- |
| InChIKey | IQTNICJWMXRODY-XDOYNYLZSA-N |
| XLogP | 2.14 |
| TPSA | 122.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|