C18H21N3O6S3 — CID 16937449
(2Z)-3-(2-ethoxyethyl)-2-(4-methoxyphenyl)sulfonylimino-1,3-benzothiazole-6-sulfonamide (PubChem CID 16937449) has the molecular formula C18H21N3O6S3 and a molecular weight of 471.58 g/mol. Its IUPAC name is (2Z)-3-(2-ethoxyethyl)-2-(4-methoxyphenyl)sulfonylimino-1,3-benzothiazole-6-sulfonamide.
| Compound Name | (2Z)-3-(2-ethoxyethyl)-2-(4-methoxyphenyl)sulfonylimino-1,3-benzothiazole-6-sulfonamide |
|---|---|
| PubChem CID | 16937449 |
| Molecular Formula | C18H21N3O6S3 |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.06 |
| IUPAC Name | (2Z)-3-(2-ethoxyethyl)-2-(4-methoxyphenyl)sulfonylimino-1,3-benzothiazole-6-sulfonamide |
| SMILES | CCOCCn1/c(=N/S(=O)(=O)c2ccc(OC)cc2)sc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C18H21N3O6S3/c1-3-27-11-10-21-16-9-8-15(29(19,22)23)12-17(16)28-18(21)20-30(24,25)14-6-4-13(26-2)5-7-14/h4-9,12H,3,10-11H2,1-2H3,(H2,19,22,23)/b20-18- |
| InChIKey | KMJPZHXZOYUZRZ-ZZEZOPTASA-N |
| XLogP | 1.68 |
| TPSA | 130.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|