C18H19ClN2O3S2 — CID 40892013
4-chloro-N-[3-(2-ethoxyethyl)-6-methyl-1,3-benzothiazol-2-ylidene]benzenesulfonamide (PubChem CID 40892013) has the molecular formula C18H19ClN2O3S2 and a molecular weight of 410.95 g/mol. Its IUPAC name is 4-chloro-N-[3-(2-ethoxyethyl)-6-methyl-1,3-benzothiazol-2-ylidene]benzenesulfonamide.
| Compound Name | 4-chloro-N-[3-(2-ethoxyethyl)-6-methyl-1,3-benzothiazol-2-ylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 40892013 |
| Molecular Formula | C18H19ClN2O3S2 |
| Molecular Weight | 410.95 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | 4-chloro-N-[3-(2-ethoxyethyl)-6-methyl-1,3-benzothiazol-2-ylidene]benzenesulfonamide |
| SMILES | CCOCCn1c(=NS(=O)(=O)c2ccc(Cl)cc2)sc2cc(C)ccc21 |
| InChI | InChI=1S/C18H19ClN2O3S2/c1-3-24-11-10-21-16-9-4-13(2)12-17(16)25-18(21)20-26(22,23)15-7-5-14(19)6-8-15/h4-9,12H,3,10-11H2,1-2H3 |
| InChIKey | VVNLYJGUDLUECB-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.95 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|