C18H20N2O5S3 — CID 16937019
(NZ)-N-[3-(2-ethoxyethyl)-6-methylsulfonyl-1,3-benzothiazol-2-ylidene]benzenesulfonamide (PubChem CID 16937019) has the molecular formula C18H20N2O5S3 and a molecular weight of 440.57 g/mol. Its IUPAC name is (NZ)-N-[3-(2-ethoxyethyl)-6-methylsulfonyl-1,3-benzothiazol-2-ylidene]benzenesulfonamide.
| Compound Name | (NZ)-N-[3-(2-ethoxyethyl)-6-methylsulfonyl-1,3-benzothiazol-2-ylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 16937019 |
| Molecular Formula | C18H20N2O5S3 |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.05 |
| IUPAC Name | (NZ)-N-[3-(2-ethoxyethyl)-6-methylsulfonyl-1,3-benzothiazol-2-ylidene]benzenesulfonamide |
| SMILES | CCOCCn1/c(=N/S(=O)(=O)c2ccccc2)sc2cc(S(C)(=O)=O)ccc21 |
| InChI | InChI=1S/C18H20N2O5S3/c1-3-25-12-11-20-16-10-9-15(27(2,21)22)13-17(16)26-18(20)19-28(23,24)14-7-5-4-6-8-14/h4-10,13H,3,11-12H2,1-2H3/b19-18- |
| InChIKey | JWAUIRXEICTQTJ-HNENSFHCSA-N |
| XLogP | 2.43 |
| TPSA | 94.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|