C19H21N3O4S2 — CID 40849357
N-[2-(benzenesulfonylimino)-3-(2-ethoxyethyl)-1,3-benzothiazol-6-yl]acetamide (PubChem CID 40849357) has the molecular formula C19H21N3O4S2 and a molecular weight of 419.53 g/mol. Its IUPAC name is N-[2-(benzenesulfonylimino)-3-(2-ethoxyethyl)-1,3-benzothiazol-6-yl]acetamide.
| Compound Name | N-[2-(benzenesulfonylimino)-3-(2-ethoxyethyl)-1,3-benzothiazol-6-yl]acetamide |
|---|---|
| PubChem CID | 40849357 |
| Molecular Formula | C19H21N3O4S2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | N-[2-(benzenesulfonylimino)-3-(2-ethoxyethyl)-1,3-benzothiazol-6-yl]acetamide |
| SMILES | CCOCCn1c(=NS(=O)(=O)c2ccccc2)sc2cc(NC(C)=O)ccc21 |
| InChI | InChI=1S/C19H21N3O4S2/c1-3-26-12-11-22-17-10-9-15(20-14(2)23)13-18(17)27-19(22)21-28(24,25)16-7-5-4-6-8-16/h4-10,13H,3,11-12H2,1-2H3,(H,20,23) |
| InChIKey | DYJNQRSPXWKTMG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 89.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|