C23H27N3O6S2 — CID 25408098
N-[6-acetamido-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-3-(4-methoxyphenyl)sulfonylpropanamide (PubChem CID 25408098) has the molecular formula C23H27N3O6S2 and a molecular weight of 505.62 g/mol. Its IUPAC name is N-[6-acetamido-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-3-(4-methoxyphenyl)sulfonylpropanamide.
| Compound Name | N-[6-acetamido-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-3-(4-methoxyphenyl)sulfonylpropanamide |
|---|---|
| PubChem CID | 25408098 |
| Molecular Formula | C23H27N3O6S2 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.13 |
| IUPAC Name | N-[6-acetamido-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-3-(4-methoxyphenyl)sulfonylpropanamide |
| SMILES | CCOCCn1/c(=N/C(=O)CCS(=O)(=O)c2ccc(OC)cc2)sc2cc(NC(C)=O)ccc21 |
| InChI | InChI=1S/C23H27N3O6S2/c1-4-32-13-12-26-20-10-5-17(24-16(2)27)15-21(20)33-23(26)25-22(28)11-14-34(29,30)19-8-6-18(31-3)7-9-19/h5-10,15H,4,11-14H2,1-3H3,(H,24,27)/b25-23- |
| InChIKey | AHFURHXZFSOSEK-BZZOAKBMSA-N |
| XLogP | 3.00 |
| TPSA | 116.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|