C22H23N3O5S — CID 3639416
methyl 4-[[6-acetamido-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]carbamoyl]benzoate (PubChem CID 3639416) has the molecular formula C22H23N3O5S and a molecular weight of 441.51 g/mol. Its IUPAC name is methyl 4-[[6-acetamido-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]carbamoyl]benzoate.
| Compound Name | methyl 4-[[6-acetamido-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]carbamoyl]benzoate |
|---|---|
| PubChem CID | 3639416 |
| Molecular Formula | C22H23N3O5S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | methyl 4-[[6-acetamido-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]carbamoyl]benzoate |
| SMILES | CCOCCn1/c(=N/C(=O)c2ccc(C(=O)OC)cc2)sc2cc(NC(C)=O)ccc21 |
| InChI | InChI=1S/C22H23N3O5S/c1-4-30-12-11-25-18-10-9-17(23-14(2)26)13-19(18)31-22(25)24-20(27)15-5-7-16(8-6-15)21(28)29-3/h5-10,13H,4,11-12H2,1-3H3,(H,23,26)/b24-22- |
| InChIKey | LODHCGGPVXVEMY-GYHWCHFESA-N |
| XLogP | 3.23 |
| TPSA | 98.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|