C22H24N2O6S — CID 4060413
methyl 2-(2,6-dimethoxybenzoyl)imino-3-(2-ethoxyethyl)-1,3-benzothiazole-6-carboxylate (PubChem CID 4060413) has the molecular formula C22H24N2O6S and a molecular weight of 444.51 g/mol. Its IUPAC name is methyl 2-(2,6-dimethoxybenzoyl)imino-3-(2-ethoxyethyl)-1,3-benzothiazole-6-carboxylate.
| Compound Name | methyl 2-(2,6-dimethoxybenzoyl)imino-3-(2-ethoxyethyl)-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 4060413 |
| Molecular Formula | C22H24N2O6S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | methyl 2-(2,6-dimethoxybenzoyl)imino-3-(2-ethoxyethyl)-1,3-benzothiazole-6-carboxylate |
| SMILES | CCOCCn1/c(=N/C(=O)c2c(OC)cccc2OC)sc2cc(C(=O)OC)ccc21 |
| InChI | InChI=1S/C22H24N2O6S/c1-5-30-12-11-24-15-10-9-14(21(26)29-4)13-18(15)31-22(24)23-20(25)19-16(27-2)7-6-8-17(19)28-3/h6-10,13H,5,11-12H2,1-4H3/b23-22- |
| InChIKey | NVXHBPXVNMBHOR-FCQUAONHSA-N |
| XLogP | 3.28 |
| TPSA | 88.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|