C24H28N2O5S — CID 3443172
methyl 2-(4-butoxybenzoyl)imino-3-(2-ethoxyethyl)-1,3-benzothiazole-6-carboxylate (PubChem CID 3443172) has the molecular formula C24H28N2O5S and a molecular weight of 456.56 g/mol. Its IUPAC name is methyl 2-(4-butoxybenzoyl)imino-3-(2-ethoxyethyl)-1,3-benzothiazole-6-carboxylate.
| Compound Name | methyl 2-(4-butoxybenzoyl)imino-3-(2-ethoxyethyl)-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 3443172 |
| Molecular Formula | C24H28N2O5S |
| Molecular Weight | 456.56 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | methyl 2-(4-butoxybenzoyl)imino-3-(2-ethoxyethyl)-1,3-benzothiazole-6-carboxylate |
| SMILES | CCCCOc1ccc(C(=O)/N=c2\sc3cc(C(=O)OC)ccc3n2CCOCC)cc1 |
| InChI | InChI=1S/C24H28N2O5S/c1-4-6-14-31-19-10-7-17(8-11-19)22(27)25-24-26(13-15-30-5-2)20-12-9-18(23(28)29-3)16-21(20)32-24/h7-12,16H,4-6,13-15H2,1-3H3/b25-24- |
| InChIKey | KENWVNWNRFIXTF-IZHYLOQSSA-N |
| XLogP | 4.45 |
| TPSA | 79.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.56 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|