C20H21FN2O3S — CID 4247343
N-[6-ethoxy-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-4-fluorobenzamide (PubChem CID 4247343) has the molecular formula C20H21FN2O3S and a molecular weight of 388.46 g/mol. Its IUPAC name is N-[6-ethoxy-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-4-fluorobenzamide.
| Compound Name | N-[6-ethoxy-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-4-fluorobenzamide |
|---|---|
| PubChem CID | 4247343 |
| Molecular Formula | C20H21FN2O3S |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | N-[6-ethoxy-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-4-fluorobenzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2ccc(F)cc2)sc2cc(OCC)ccc21 |
| InChI | InChI=1S/C20H21FN2O3S/c1-3-25-12-11-23-17-10-9-16(26-4-2)13-18(17)27-20(23)22-19(24)14-5-7-15(21)8-6-14/h5-10,13H,3-4,11-12H2,1-2H3/b22-20- |
| InChIKey | PIYDASMRAWHNDH-XDOYNYLZSA-N |
| XLogP | 4.02 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|