C26H26N2O4S — CID 4085221
N-[6-ethoxy-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-3-phenoxybenzamide (PubChem CID 4085221) has the molecular formula C26H26N2O4S and a molecular weight of 462.57 g/mol. Its IUPAC name is N-[6-ethoxy-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-3-phenoxybenzamide.
| Compound Name | N-[6-ethoxy-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-3-phenoxybenzamide |
|---|---|
| PubChem CID | 4085221 |
| Molecular Formula | C26H26N2O4S |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | N-[6-ethoxy-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-3-phenoxybenzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2cccc(Oc3ccccc3)c2)sc2cc(OCC)ccc21 |
| InChI | InChI=1S/C26H26N2O4S/c1-3-30-16-15-28-23-14-13-21(31-4-2)18-24(23)33-26(28)27-25(29)19-9-8-12-22(17-19)32-20-10-6-5-7-11-20/h5-14,17-18H,3-4,15-16H2,1-2H3/b27-26- |
| InChIKey | XPJKILIQCAXHMP-RQZHXJHFSA-N |
| XLogP | 5.67 |
| TPSA | 62.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|