C26H26FN3O5S2 — CID 121042116
N-[6-ethoxy-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-3-[(4-fluorophenyl)sulfonylamino]benzamide (PubChem CID 121042116) has the molecular formula C26H26FN3O5S2 and a molecular weight of 543.64 g/mol. Its IUPAC name is N-[6-ethoxy-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-3-[(4-fluorophenyl)sulfonylamino]benzamide.
| Compound Name | N-[6-ethoxy-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-3-[(4-fluorophenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 121042116 |
| Molecular Formula | C26H26FN3O5S2 |
| Molecular Weight | 543.64 g/mol |
| Exact Mass | 543.13 |
| IUPAC Name | N-[6-ethoxy-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-3-[(4-fluorophenyl)sulfonylamino]benzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2cccc(NS(=O)(=O)c3ccc(F)cc3)c2)sc2cc(OCC)ccc21 |
| InChI | InChI=1S/C26H26FN3O5S2/c1-3-34-15-14-30-23-13-10-21(35-4-2)17-24(23)36-26(30)28-25(31)18-6-5-7-20(16-18)29-37(32,33)22-11-8-19(27)9-12-22/h5-13,16-17,29H,3-4,14-15H2,1-2H3/b28-26- |
| InChIKey | CUQOSYVGYYGPAZ-SGEDCAFJSA-N |
| XLogP | 4.82 |
| TPSA | 98.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.64 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|