C24H20F3N3O4S2 — CID 121042120
N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]-3-[(4-fluorophenyl)sulfonylamino]benzamide (PubChem CID 121042120) has the molecular formula C24H20F3N3O4S2 and a molecular weight of 535.57 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]-3-[(4-fluorophenyl)sulfonylamino]benzamide.
| Compound Name | N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]-3-[(4-fluorophenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 121042120 |
| Molecular Formula | C24H20F3N3O4S2 |
| Molecular Weight | 535.57 g/mol |
| Exact Mass | 535.08 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]-3-[(4-fluorophenyl)sulfonylamino]benzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2cccc(NS(=O)(=O)c3ccc(F)cc3)c2)sc2cc(F)cc(F)c21 |
| InChI | InChI=1S/C24H20F3N3O4S2/c1-2-34-11-10-30-22-20(27)13-17(26)14-21(22)35-24(30)28-23(31)15-4-3-5-18(12-15)29-36(32,33)19-8-6-16(25)7-9-19/h3-9,12-14,29H,2,10-11H2,1H3/b28-24- |
| InChIKey | HZWJMTGHCALUEG-COOPMVRXSA-N |
| XLogP | 4.70 |
| TPSA | 89.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.57 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|