C25H24FN3O5S2 — CID 121045406
N-[3-(2-ethoxyethyl)-4-fluoro-1,3-benzothiazol-2-ylidene]-4-[(4-methoxyphenyl)sulfonylamino]benzamide (PubChem CID 121045406) has the molecular formula C25H24FN3O5S2 and a molecular weight of 529.62 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-4-fluoro-1,3-benzothiazol-2-ylidene]-4-[(4-methoxyphenyl)sulfonylamino]benzamide.
| Compound Name | N-[3-(2-ethoxyethyl)-4-fluoro-1,3-benzothiazol-2-ylidene]-4-[(4-methoxyphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 121045406 |
| Molecular Formula | C25H24FN3O5S2 |
| Molecular Weight | 529.62 g/mol |
| Exact Mass | 529.11 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-4-fluoro-1,3-benzothiazol-2-ylidene]-4-[(4-methoxyphenyl)sulfonylamino]benzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2ccc(NS(=O)(=O)c3ccc(OC)cc3)cc2)sc2cccc(F)c21 |
| InChI | InChI=1S/C25H24FN3O5S2/c1-3-34-16-15-29-23-21(26)5-4-6-22(23)35-25(29)27-24(30)17-7-9-18(10-8-17)28-36(31,32)20-13-11-19(33-2)12-14-20/h4-14,28H,3,15-16H2,1-2H3/b27-25- |
| InChIKey | AXIMBJNFHDNREV-RFBIWTDZSA-N |
| XLogP | 4.43 |
| TPSA | 98.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.62 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|