C27H27N3O6S2 — CID 121044127
methyl 3-(2-ethoxyethyl)-2-[4-[(4-methylphenyl)sulfonylamino]benzoyl]imino-1,3-benzothiazole-6-carboxylate (PubChem CID 121044127) has the molecular formula C27H27N3O6S2 and a molecular weight of 553.66 g/mol. Its IUPAC name is methyl 3-(2-ethoxyethyl)-2-[4-[(4-methylphenyl)sulfonylamino]benzoyl]imino-1,3-benzothiazole-6-carboxylate.
| Compound Name | methyl 3-(2-ethoxyethyl)-2-[4-[(4-methylphenyl)sulfonylamino]benzoyl]imino-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 121044127 |
| Molecular Formula | C27H27N3O6S2 |
| Molecular Weight | 553.66 g/mol |
| Exact Mass | 553.13 |
| IUPAC Name | methyl 3-(2-ethoxyethyl)-2-[4-[(4-methylphenyl)sulfonylamino]benzoyl]imino-1,3-benzothiazole-6-carboxylate |
| SMILES | CCOCCn1/c(=N/C(=O)c2ccc(NS(=O)(=O)c3ccc(C)cc3)cc2)sc2cc(C(=O)OC)ccc21 |
| InChI | InChI=1S/C27H27N3O6S2/c1-4-36-16-15-30-23-14-9-20(26(32)35-3)17-24(23)37-27(30)28-25(31)19-7-10-21(11-8-19)29-38(33,34)22-12-5-18(2)6-13-22/h5-14,17,29H,4,15-16H2,1-3H3/b28-27- |
| InChIKey | JJMYMAWGRPHREF-DQSJHHFOSA-N |
| XLogP | 4.38 |
| TPSA | 116.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.66 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|