C25H26N4O6S3 — CID 121042512
N-[3-(2-ethoxyethyl)-6-sulfamoyl-1,3-benzothiazol-2-ylidene]-3-[(4-methylphenyl)sulfonylamino]benzamide (PubChem CID 121042512) has the molecular formula C25H26N4O6S3 and a molecular weight of 574.71 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-6-sulfamoyl-1,3-benzothiazol-2-ylidene]-3-[(4-methylphenyl)sulfonylamino]benzamide.
| Compound Name | N-[3-(2-ethoxyethyl)-6-sulfamoyl-1,3-benzothiazol-2-ylidene]-3-[(4-methylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 121042512 |
| Molecular Formula | C25H26N4O6S3 |
| Molecular Weight | 574.71 g/mol |
| Exact Mass | 574.10 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-6-sulfamoyl-1,3-benzothiazol-2-ylidene]-3-[(4-methylphenyl)sulfonylamino]benzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2cccc(NS(=O)(=O)c3ccc(C)cc3)c2)sc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C25H26N4O6S3/c1-3-35-14-13-29-22-12-11-21(37(26,31)32)16-23(22)36-25(29)27-24(30)18-5-4-6-19(15-18)28-38(33,34)20-9-7-17(2)8-10-20/h4-12,15-16,28H,3,13-14H2,1-2H3,(H2,26,31,32)/b27-25- |
| InChIKey | KXWKJGZBZODCLE-RFBIWTDZSA-N |
| XLogP | 3.24 |
| TPSA | 149.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.71 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|