C20H23N3O6S3 — CID 42524603
N-[3-(2-ethoxyethyl)-6-sulfamoyl-1,3-benzothiazol-2-ylidene]-4-ethylsulfonylbenzamide (PubChem CID 42524603) has the molecular formula C20H23N3O6S3 and a molecular weight of 497.62 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-6-sulfamoyl-1,3-benzothiazol-2-ylidene]-4-ethylsulfonylbenzamide.
| Compound Name | N-[3-(2-ethoxyethyl)-6-sulfamoyl-1,3-benzothiazol-2-ylidene]-4-ethylsulfonylbenzamide |
|---|---|
| PubChem CID | 42524603 |
| Molecular Formula | C20H23N3O6S3 |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.07 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-6-sulfamoyl-1,3-benzothiazol-2-ylidene]-4-ethylsulfonylbenzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2ccc(S(=O)(=O)CC)cc2)sc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C20H23N3O6S3/c1-3-29-12-11-23-17-10-9-16(32(21,27)28)13-18(17)30-20(23)22-19(24)14-5-7-15(8-6-14)31(25,26)4-2/h5-10,13H,3-4,11-12H2,1-2H3,(H2,21,27,28)/b22-20- |
| InChIKey | FGZIMPIFBVDOIJ-XDOYNYLZSA-N |
| XLogP | 1.92 |
| TPSA | 137.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|