C16H18N4O5S2 — CID 16880033
N-[3-(2-ethoxyethyl)-6-sulfamoyl-1,3-benzothiazol-2-ylidene]-3-methyl-1,2-oxazole-5-carboxamide (PubChem CID 16880033) has the molecular formula C16H18N4O5S2 and a molecular weight of 410.48 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-6-sulfamoyl-1,3-benzothiazol-2-ylidene]-3-methyl-1,2-oxazole-5-carboxamide.
| Compound Name | N-[3-(2-ethoxyethyl)-6-sulfamoyl-1,3-benzothiazol-2-ylidene]-3-methyl-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 16880033 |
| Molecular Formula | C16H18N4O5S2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-6-sulfamoyl-1,3-benzothiazol-2-ylidene]-3-methyl-1,2-oxazole-5-carboxamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2cc(C)no2)sc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C16H18N4O5S2/c1-3-24-7-6-20-12-5-4-11(27(17,22)23)9-14(12)26-16(20)18-15(21)13-8-10(2)19-25-13/h4-5,8-9H,3,6-7H2,1-2H3,(H2,17,22,23)/b18-16- |
| InChIKey | GRNKKWOCZSFLJN-VLGSPTGOSA-N |
| XLogP | 1.42 |
| TPSA | 129.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|