C19H18N4O4S3 — CID 3624695
N-[3-(2-ethoxyethyl)-6-sulfamoyl-1,3-benzothiazol-2-ylidene]-1,3-benzothiazole-6-carboxamide (PubChem CID 3624695) has the molecular formula C19H18N4O4S3 and a molecular weight of 462.58 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-6-sulfamoyl-1,3-benzothiazol-2-ylidene]-1,3-benzothiazole-6-carboxamide.
| Compound Name | N-[3-(2-ethoxyethyl)-6-sulfamoyl-1,3-benzothiazol-2-ylidene]-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 3624695 |
| Molecular Formula | C19H18N4O4S3 |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.05 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-6-sulfamoyl-1,3-benzothiazol-2-ylidene]-1,3-benzothiazole-6-carboxamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2ccc3ncsc3c2)sc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C19H18N4O4S3/c1-2-27-8-7-23-15-6-4-13(30(20,25)26)10-17(15)29-19(23)22-18(24)12-3-5-14-16(9-12)28-11-21-14/h3-6,9-11H,2,7-8H2,1H3,(H2,20,25,26)/b22-19- |
| InChIKey | LUZNZPVQPWXFCK-QOCHGBHMSA-N |
| XLogP | 2.74 |
| TPSA | 116.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|