C19H16FN3O2S2 — CID 5086166
N-[3-(2-ethoxyethyl)-6-fluoro-1,3-benzothiazol-2-ylidene]-1,3-benzothiazole-6-carboxamide (PubChem CID 5086166) has the molecular formula C19H16FN3O2S2 and a molecular weight of 401.49 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-6-fluoro-1,3-benzothiazol-2-ylidene]-1,3-benzothiazole-6-carboxamide.
| Compound Name | N-[3-(2-ethoxyethyl)-6-fluoro-1,3-benzothiazol-2-ylidene]-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 5086166 |
| Molecular Formula | C19H16FN3O2S2 |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-6-fluoro-1,3-benzothiazol-2-ylidene]-1,3-benzothiazole-6-carboxamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2ccc3ncsc3c2)sc2cc(F)ccc21 |
| InChI | InChI=1S/C19H16FN3O2S2/c1-2-25-8-7-23-15-6-4-13(20)10-17(15)27-19(23)22-18(24)12-3-5-14-16(9-12)26-11-21-14/h3-6,9-11H,2,7-8H2,1H3/b22-19- |
| InChIKey | KVTAEQCSMKIIPX-QOCHGBHMSA-N |
| XLogP | 4.23 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|