C21H20N4O3S — CID 43938276
N-[3-(2-ethoxyethyl)-6-methoxy-1,3-benzothiazol-2-ylidene]quinoxaline-6-carboxamide (PubChem CID 43938276) has the molecular formula C21H20N4O3S and a molecular weight of 408.48 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-6-methoxy-1,3-benzothiazol-2-ylidene]quinoxaline-6-carboxamide.
| Compound Name | N-[3-(2-ethoxyethyl)-6-methoxy-1,3-benzothiazol-2-ylidene]quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 43938276 |
| Molecular Formula | C21H20N4O3S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-6-methoxy-1,3-benzothiazol-2-ylidene]quinoxaline-6-carboxamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2ccc3nccnc3c2)sc2cc(OC)ccc21 |
| InChI | InChI=1S/C21H20N4O3S/c1-3-28-11-10-25-18-7-5-15(27-2)13-19(18)29-21(25)24-20(26)14-4-6-16-17(12-14)23-9-8-22-16/h4-9,12-13H,3,10-11H2,1-2H3/b24-21- |
| InChIKey | YUUIMGJGYFQZCZ-FLFQWRMESA-N |
| XLogP | 3.43 |
| TPSA | 78.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|