C19H18N4O7S — CID 5068202
N-[3-(2-ethoxyethyl)-6-methoxy-1,3-benzothiazol-2-ylidene]-3,5-dinitrobenzamide (PubChem CID 5068202) has the molecular formula C19H18N4O7S and a molecular weight of 446.44 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-6-methoxy-1,3-benzothiazol-2-ylidene]-3,5-dinitrobenzamide.
| Compound Name | N-[3-(2-ethoxyethyl)-6-methoxy-1,3-benzothiazol-2-ylidene]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 5068202 |
| Molecular Formula | C19H18N4O7S |
| Molecular Weight | 446.44 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-6-methoxy-1,3-benzothiazol-2-ylidene]-3,5-dinitrobenzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)sc2cc(OC)ccc21 |
| InChI | InChI=1S/C19H18N4O7S/c1-3-30-7-6-21-16-5-4-15(29-2)11-17(16)31-19(21)20-18(24)12-8-13(22(25)26)10-14(9-12)23(27)28/h4-5,8-11H,3,6-7H2,1-2H3/b20-19- |
| InChIKey | MCVHGBVISWORFO-VXPUYCOJSA-N |
| XLogP | 3.31 |
| TPSA | 139.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|