C24H29N3O7S — CID 3328480
3,4,5-triethoxy-N-[3-(2-ethoxyethyl)-6-nitro-1,3-benzothiazol-2-ylidene]benzamide (PubChem CID 3328480) has the molecular formula C24H29N3O7S and a molecular weight of 503.58 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[3-(2-ethoxyethyl)-6-nitro-1,3-benzothiazol-2-ylidene]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[3-(2-ethoxyethyl)-6-nitro-1,3-benzothiazol-2-ylidene]benzamide |
|---|---|
| PubChem CID | 3328480 |
| Molecular Formula | C24H29N3O7S |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | 3,4,5-triethoxy-N-[3-(2-ethoxyethyl)-6-nitro-1,3-benzothiazol-2-ylidene]benzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2cc(OCC)c(OCC)c(OCC)c2)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C24H29N3O7S/c1-5-31-12-11-26-18-10-9-17(27(29)30)15-21(18)35-24(26)25-23(28)16-13-19(32-6-2)22(34-8-4)20(14-16)33-7-3/h9-10,13-15H,5-8,11-12H2,1-4H3/b25-24- |
| InChIKey | NXPFKNQMHSSPAX-IZHYLOQSSA-N |
| XLogP | 4.58 |
| TPSA | 114.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|