C19H19N3O5S2 — CID 40903143
(Z)-N-[3-(2-ethoxyethyl)-6-methoxy-1,3-benzothiazol-2-ylidene]-3-(5-nitrothiophen-2-yl)prop-2-enamide (PubChem CID 40903143) has the molecular formula C19H19N3O5S2 and a molecular weight of 433.51 g/mol. Its IUPAC name is (Z)-N-[3-(2-ethoxyethyl)-6-methoxy-1,3-benzothiazol-2-ylidene]-3-(5-nitrothiophen-2-yl)prop-2-enamide.
| Compound Name | (Z)-N-[3-(2-ethoxyethyl)-6-methoxy-1,3-benzothiazol-2-ylidene]-3-(5-nitrothiophen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 40903143 |
| Molecular Formula | C19H19N3O5S2 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | (Z)-N-[3-(2-ethoxyethyl)-6-methoxy-1,3-benzothiazol-2-ylidene]-3-(5-nitrothiophen-2-yl)prop-2-enamide |
| SMILES | CCOCCn1/c(=N/C(=O)/C=C\c2ccc([N+](=O)[O-])s2)sc2cc(OC)ccc21 |
| InChI | InChI=1S/C19H19N3O5S2/c1-3-27-11-10-21-15-7-4-13(26-2)12-16(15)29-19(21)20-17(23)8-5-14-6-9-18(28-14)22(24)25/h4-9,12H,3,10-11H2,1-2H3/b8-5-,20-19- |
| InChIKey | IVLOJXZTJJDANT-JGAREDLESA-N |
| XLogP | 3.86 |
| TPSA | 95.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|