C20H17N3O7S2 — CID 4157375
ethyl 3-(2-methoxy-2-oxoethyl)-2-[3-(5-nitrothiophen-2-yl)prop-2-enoylimino]-1,3-benzothiazole-6-carboxylate (PubChem CID 4157375) has the molecular formula C20H17N3O7S2 and a molecular weight of 475.50 g/mol. Its IUPAC name is ethyl 3-(2-methoxy-2-oxoethyl)-2-[3-(5-nitrothiophen-2-yl)prop-2-enoylimino]-1,3-benzothiazole-6-carboxylate.
| Compound Name | ethyl 3-(2-methoxy-2-oxoethyl)-2-[3-(5-nitrothiophen-2-yl)prop-2-enoylimino]-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 4157375 |
| Molecular Formula | C20H17N3O7S2 |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.05 |
| IUPAC Name | ethyl 3-(2-methoxy-2-oxoethyl)-2-[3-(5-nitrothiophen-2-yl)prop-2-enoylimino]-1,3-benzothiazole-6-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)s/c(=N\C(=O)C=Cc1ccc([N+](=O)[O-])s1)n2CC(=O)OC |
| InChI | InChI=1S/C20H17N3O7S2/c1-3-30-19(26)12-4-7-14-15(10-12)32-20(22(14)11-18(25)29-2)21-16(24)8-5-13-6-9-17(31-13)23(27)28/h4-10H,3,11H2,1-2H3/b8-5?,21-20- |
| InChIKey | RZRCEXHFVSWLLG-AMVWOTPDSA-N |
| XLogP | 3.16 |
| TPSA | 130.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|