C18H16N4O7S3 — CID 43939596
ethyl 2-[2-[(Z)-3-(5-nitrothiophen-2-yl)prop-2-enoyl]imino-6-sulfamoyl-1,3-benzothiazol-3-yl]acetate (PubChem CID 43939596) has the molecular formula C18H16N4O7S3 and a molecular weight of 496.55 g/mol. Its IUPAC name is ethyl 2-[2-[(Z)-3-(5-nitrothiophen-2-yl)prop-2-enoyl]imino-6-sulfamoyl-1,3-benzothiazol-3-yl]acetate.
| Compound Name | ethyl 2-[2-[(Z)-3-(5-nitrothiophen-2-yl)prop-2-enoyl]imino-6-sulfamoyl-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 43939596 |
| Molecular Formula | C18H16N4O7S3 |
| Molecular Weight | 496.55 g/mol |
| Exact Mass | 496.02 |
| IUPAC Name | ethyl 2-[2-[(Z)-3-(5-nitrothiophen-2-yl)prop-2-enoyl]imino-6-sulfamoyl-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCOC(=O)Cn1/c(=N/C(=O)/C=C\c2ccc([N+](=O)[O-])s2)sc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C18H16N4O7S3/c1-2-29-17(24)10-21-13-6-5-12(32(19,27)28)9-14(13)31-18(21)20-15(23)7-3-11-4-8-16(30-11)22(25)26/h3-9H,2,10H2,1H3,(H2,19,27,28)/b7-3-,20-18- |
| InChIKey | RJTMVDMWNLSKQG-VNHLZHPJSA-N |
| XLogP | 2.02 |
| TPSA | 163.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.55 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|