C20H18N4O7S2 — CID 4130687
ethyl 2-[2-[3-(4-nitrophenyl)prop-2-enoylimino]-6-sulfamoyl-1,3-benzothiazol-3-yl]acetate (PubChem CID 4130687) has the molecular formula C20H18N4O7S2 and a molecular weight of 490.52 g/mol. Its IUPAC name is ethyl 2-[2-[3-(4-nitrophenyl)prop-2-enoylimino]-6-sulfamoyl-1,3-benzothiazol-3-yl]acetate.
| Compound Name | ethyl 2-[2-[3-(4-nitrophenyl)prop-2-enoylimino]-6-sulfamoyl-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 4130687 |
| Molecular Formula | C20H18N4O7S2 |
| Molecular Weight | 490.52 g/mol |
| Exact Mass | 490.06 |
| IUPAC Name | ethyl 2-[2-[3-(4-nitrophenyl)prop-2-enoylimino]-6-sulfamoyl-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCOC(=O)Cn1/c(=N/C(=O)C=Cc2ccc([N+](=O)[O-])cc2)sc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C20H18N4O7S2/c1-2-31-19(26)12-23-16-9-8-15(33(21,29)30)11-17(16)32-20(23)22-18(25)10-5-13-3-6-14(7-4-13)24(27)28/h3-11H,2,12H2,1H3,(H2,21,29,30)/b10-5?,22-20- |
| InChIKey | AWXLOVALRCOOIA-SSSHQWAASA-N |
| XLogP | 1.96 |
| TPSA | 163.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.52 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|