C21H17N3O7S — CID 41007084
ethyl 2-[6-[(Z)-3-(4-nitrophenyl)prop-2-enoyl]imino-[1,3]dioxolo[4,5-f][1,3]benzothiazol-7-yl]acetate (PubChem CID 41007084) has the molecular formula C21H17N3O7S and a molecular weight of 455.45 g/mol. Its IUPAC name is ethyl 2-[6-[(Z)-3-(4-nitrophenyl)prop-2-enoyl]imino-[1,3]dioxolo[4,5-f][1,3]benzothiazol-7-yl]acetate.
| Compound Name | ethyl 2-[6-[(Z)-3-(4-nitrophenyl)prop-2-enoyl]imino-[1,3]dioxolo[4,5-f][1,3]benzothiazol-7-yl]acetate |
|---|---|
| PubChem CID | 41007084 |
| Molecular Formula | C21H17N3O7S |
| Molecular Weight | 455.45 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | ethyl 2-[6-[(Z)-3-(4-nitrophenyl)prop-2-enoyl]imino-[1,3]dioxolo[4,5-f][1,3]benzothiazol-7-yl]acetate |
| SMILES | CCOC(=O)Cn1/c(=N/C(=O)/C=C\c2ccc([N+](=O)[O-])cc2)sc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C21H17N3O7S/c1-2-29-20(26)11-23-15-9-16-17(31-12-30-16)10-18(15)32-21(23)22-19(25)8-5-13-3-6-14(7-4-13)24(27)28/h3-10H,2,11-12H2,1H3/b8-5-,22-21- |
| InChIKey | MOTNHYOUWIFDKU-QHNXCTGSSA-N |
| XLogP | 3.04 |
| TPSA | 122.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.45 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|