C20H13N3O5S — CID 74711521
3-(3-nitrophenyl)-N-(7-prop-2-ynyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)prop-2-enamide (PubChem CID 74711521) has the molecular formula C20H13N3O5S and a molecular weight of 407.41 g/mol. Its IUPAC name is 3-(3-nitrophenyl)-N-(7-prop-2-ynyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)prop-2-enamide.
| Compound Name | 3-(3-nitrophenyl)-N-(7-prop-2-ynyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)prop-2-enamide |
|---|---|
| PubChem CID | 74711521 |
| Molecular Formula | C20H13N3O5S |
| Molecular Weight | 407.41 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | 3-(3-nitrophenyl)-N-(7-prop-2-ynyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)prop-2-enamide |
| SMILES | C#CCn1/c(=N/C(=O)C=Cc2cccc([N+](=O)[O-])c2)sc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C20H13N3O5S/c1-2-8-22-15-10-16-17(28-12-27-16)11-18(15)29-20(22)21-19(24)7-6-13-4-3-5-14(9-13)23(25)26/h1,3-7,9-11H,8,12H2/b7-6?,21-20- |
| InChIKey | QNOPBHSPKMSADT-JHRYQTBKSA-N |
| XLogP | 3.11 |
| TPSA | 95.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|