C18H14N4O5S — CID 73337884
N-(3-ethyl-5-nitro-1,3-benzothiazol-2-ylidene)-3-(3-nitrophenyl)prop-2-enamide (PubChem CID 73337884) has the molecular formula C18H14N4O5S and a molecular weight of 398.40 g/mol. Its IUPAC name is N-(3-ethyl-5-nitro-1,3-benzothiazol-2-ylidene)-3-(3-nitrophenyl)prop-2-enamide.
| Compound Name | N-(3-ethyl-5-nitro-1,3-benzothiazol-2-ylidene)-3-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 73337884 |
| Molecular Formula | C18H14N4O5S |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | N-(3-ethyl-5-nitro-1,3-benzothiazol-2-ylidene)-3-(3-nitrophenyl)prop-2-enamide |
| SMILES | CCn1/c(=N/C(=O)C=Cc2cccc([N+](=O)[O-])c2)sc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C18H14N4O5S/c1-2-20-15-11-14(22(26)27)7-8-16(15)28-18(20)19-17(23)9-6-12-4-3-5-13(10-12)21(24)25/h3-11H,2H2,1H3/b9-6?,19-18- |
| InChIKey | CCTAMQKPRHXIRI-ZKBCIFPVSA-N |
| XLogP | 3.68 |
| TPSA | 120.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|