C19H18N4O5S2 — CID 74909068
3-(3-nitrophenyl)-N-(3-propyl-6-sulfamoyl-1,3-benzothiazol-2-ylidene)prop-2-enamide (PubChem CID 74909068) has the molecular formula C19H18N4O5S2 and a molecular weight of 446.51 g/mol. Its IUPAC name is 3-(3-nitrophenyl)-N-(3-propyl-6-sulfamoyl-1,3-benzothiazol-2-ylidene)prop-2-enamide.
| Compound Name | 3-(3-nitrophenyl)-N-(3-propyl-6-sulfamoyl-1,3-benzothiazol-2-ylidene)prop-2-enamide |
|---|---|
| PubChem CID | 74909068 |
| Molecular Formula | C19H18N4O5S2 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | 3-(3-nitrophenyl)-N-(3-propyl-6-sulfamoyl-1,3-benzothiazol-2-ylidene)prop-2-enamide |
| SMILES | CCCn1/c(=N/C(=O)C=Cc2cccc([N+](=O)[O-])c2)sc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C19H18N4O5S2/c1-2-10-22-16-8-7-15(30(20,27)28)12-17(16)29-19(22)21-18(24)9-6-13-4-3-5-14(11-13)23(25)26/h3-9,11-12H,2,10H2,1H3,(H2,20,27,28)/b9-6?,21-19- |
| InChIKey | MHRRZZRQNUGZEL-KZQCMNPTSA-N |
| XLogP | 2.81 |
| TPSA | 137.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|